C34H31F3N4O3 — CID 170956488
4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 170956488) has the molecular formula C34H31F3N4O3 and a molecular weight of 600.64 g/mol. Its IUPAC name is 4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 170956488 |
| Molecular Formula | C34H31F3N4O3 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ccc4c(N5CC6COCC6C5)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C34H31F3N4O3/c1-2-24-28(36)7-4-19-10-23(42)11-27(29(19)24)25-5-6-26-31(30(25)37)38-33(39-32(26)40-13-20-16-43-17-21(20)14-40)44-18-34-8-3-9-41(34)15-22(35)12-34/h1,4-7,10-11,20-22,42H,3,8-9,12-18H2/t20?,21?,22-,34+/m1/s1 |
| InChIKey | RZPAVLYWDFYFFJ-BBKZKGPVSA-N |
| XLogP | 5.45 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|