C33H29F3N6O2 — CID 170956826
1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbonitrile (PubChem CID 170956826) has the molecular formula C33H29F3N6O2 and a molecular weight of 598.63 g/mol. Its IUPAC name is 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbonitrile.
| Compound Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 170956826 |
| Molecular Formula | C33H29F3N6O2 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbonitrile |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCCC(C#N)C5)nc(OCC56CCCN5CC(F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H29F3N6O2/c1-2-23-26(35)7-6-20-11-22(43)12-24(27(20)23)29-28(36)30-25(15-38-29)31(41-9-3-5-19(14-37)16-41)40-32(39-30)44-18-33-8-4-10-42(33)17-21(34)13-33/h1,6-7,11-12,15,19,21,43H,3-5,8-10,13,16-18H2 |
| InChIKey | RAUOACFAJDCZDD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|