C28H34ClFN6 — CID 170957511
15-chloro-4-ethyl-30-fluoro-21-methylidene-1,3,5,9,22-pentazapentacyclo[23.3.1.16,10.02,7.011,16]triaconta-2,4,6(30),7,9,11(16),12,14-octaen-13-amine (PubChem CID 170957511) has the molecular formula C28H34ClFN6 and a molecular weight of 509.07 g/mol. Its IUPAC name is 15-chloro-4-ethyl-30-fluoro-21-methylidene-1,3,5,9,22-pentazapentacyclo[23.3.1.16,10.02,7.011,16]triaconta-2,4,6(30),7,9,11(16),12,14-octaen-13-amine.
| Compound Name | 15-chloro-4-ethyl-30-fluoro-21-methylidene-1,3,5,9,22-pentazapentacyclo[23.3.1.16,10.02,7.011,16]triaconta-2,4,6(30),7,9,11(16),12,14-octaen-13-amine |
|---|---|
| PubChem CID | 170957511 |
| Molecular Formula | C28H34ClFN6 |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 15-chloro-4-ethyl-30-fluoro-21-methylidene-1,3,5,9,22-pentazapentacyclo[23.3.1.16,10.02,7.011,16]triaconta-2,4,6(30),7,9,11(16),12,14-octaen-13-amine |
| SMILES | C=C1CCCCc2c(Cl)cc(N)cc2-c2ncc3c(nc(CC)nc3c2F)N2CCCC(CCN1)C2 |
| InChI | InChI=1S/C28H34ClFN6/c1-3-24-34-27-22-15-33-26(25(27)30)21-13-19(31)14-23(29)20(21)9-5-4-7-17(2)32-11-10-18-8-6-12-36(16-18)28(22)35-24/h13-15,18,32H,2-12,16,31H2,1H3 |
| InChIKey | GLONOGWSLLWZTE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|