C12H20O3S — CID 170957862
(3E,5E)-3-methoxy-7-methyl-6-methylsulfonylnona-1,3,5-triene (PubChem CID 170957862) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is (3E,5E)-3-methoxy-7-methyl-6-methylsulfonylnona-1,3,5-triene.
| Compound Name | (3E,5E)-3-methoxy-7-methyl-6-methylsulfonylnona-1,3,5-triene |
|---|---|
| PubChem CID | 170957862 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3E,5E)-3-methoxy-7-methyl-6-methylsulfonylnona-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C(C)CC)S(C)(=O)=O)OC |
| InChI | InChI=1S/C12H20O3S/c1-6-10(3)12(16(5,13)14)9-8-11(7-2)15-4/h7-10H,2,6H2,1,3-5H3/b11-8+,12-9+ |
| InChIKey | JNNZXYJALQPRNY-HZOWPXDZSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|