C21H21F3MnN4O2 — CID 170958584
1-(3,4-dihydro-2H-chromen-4-id-3-yl)-3-methoxypyrrolidine;manganese(2+);2-(trifluoromethyl)-4H-benzotriazol-4-ide (PubChem CID 170958584) has the molecular formula C21H21F3MnN4O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-id-3-yl)-3-methoxypyrrolidine;manganese(2+);2-(trifluoromethyl)-4H-benzotriazol-4-ide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-id-3-yl)-3-methoxypyrrolidine;manganese(2+);2-(trifluoromethyl)-4H-benzotriazol-4-ide |
|---|---|
| PubChem CID | 170958584 |
| Molecular Formula | C21H21F3MnN4O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-id-3-yl)-3-methoxypyrrolidine;manganese(2+);2-(trifluoromethyl)-4H-benzotriazol-4-ide |
| SMILES | COC1CCN(C2[CH-]c3ccccc3OC2)C1.FC(F)(F)n1nc2[c-]cccc2n1.[Mn+2] |
| InChI | InChI=1S/C14H18NO2.C7H3F3N3.Mn/c1-16-13-6-7-15(9-13)12-8-11-4-2-3-5-14(11)17-10-12;8-7(9,10)13-11-5-3-1-2-4-6(5)12-13;/h2-5,8,12-13H,6-7,9-10H2,1H3;1-3H;/q2*-1;+2 |
| InChIKey | DYYJEOMNNOVHJO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|