C23H24F5N3O3 — CID 170959219
(2R,3S,4S,5R)-N-[2-(1-aminocyclopropyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170959219) has the molecular formula C23H24F5N3O3 and a molecular weight of 485.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-(1-aminocyclopropyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-(1-aminocyclopropyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170959219 |
| Molecular Formula | C23H24F5N3O3 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-(1-aminocyclopropyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C4(N)CC4)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H24F5N3O3/c1-11-16(13-4-5-14(24)17(25)18(13)33-3)19(34-21(11,2)23(26,27)28)20(32)31-12-6-9-30-15(10-12)22(29)7-8-22/h4-6,9-11,16,19H,7-8,29H2,1-3H3,(H,30,31,32)/t11-,16-,19+,21+/m0/s1 |
| InChIKey | CLNUGSDVRUICOP-YFVHLLGCSA-N |
| XLogP | 4.39 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |