C21H21F5N4O3 — CID 170959228
(2R,3S,4S,5R)-N-(2-carbamimidoyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170959228) has the molecular formula C21H21F5N4O3 and a molecular weight of 472.41 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-(2-carbamimidoyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-(2-carbamimidoyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170959228 |
| Molecular Formula | C21H21F5N4O3 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2R,3S,4S,5R)-N-(2-carbamimidoyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)ccn1 |
| InChI | InChI=1S/C21H21F5N4O3/c1-9-14(11-4-5-12(22)15(23)16(11)32-3)17(33-20(9,2)21(24,25)26)19(31)30-10-6-7-29-13(8-10)18(27)28/h4-9,14,17H,1-3H3,(H3,27,28)(H,29,30,31)/t9-,14-,17+,20+/m0/s1 |
| InChIKey | RNARJUMCHHJUMU-PAFIKIDNSA-N |
| XLogP | 3.73 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|