C22H23F5N4O3 — CID 170959231
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(N'-methylcarbamimidoyl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170959231) has the molecular formula C22H23F5N4O3 and a molecular weight of 486.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(N'-methylcarbamimidoyl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(N'-methylcarbamimidoyl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170959231 |
| Molecular Formula | C22H23F5N4O3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(N'-methylcarbamimidoyl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C/N=C(\N)c1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)ccn1 |
| InChI | InChI=1S/C22H23F5N4O3/c1-10-15(12-5-6-13(23)16(24)17(12)33-4)18(34-21(10,2)22(25,26)27)20(32)31-11-7-8-30-14(9-11)19(28)29-3/h5-10,15,18H,1-4H3,(H2,28,29)(H,30,31,32)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | JYKXZXNGKWAKRN-TZDAZOALSA-N |
| XLogP | 3.78 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|