C22H24F5N3O4 — CID 170959240
(2R,3S,4S,5R)-N-[2-(1-amino-2-hydroxyethyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170959240) has the molecular formula C22H24F5N3O4 and a molecular weight of 489.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-(1-amino-2-hydroxyethyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-(1-amino-2-hydroxyethyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170959240 |
| Molecular Formula | C22H24F5N3O4 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-(1-amino-2-hydroxyethyl)-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)CO)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H24F5N3O4/c1-10-16(12-4-5-13(23)17(24)18(12)33-3)19(34-21(10,2)22(25,26)27)20(32)30-11-6-7-29-15(8-11)14(28)9-31/h4-8,10,14,16,19,31H,9,28H2,1-3H3,(H,29,30,32)/t10-,14?,16-,19+,21+/m0/s1 |
| InChIKey | KJLDOFBBAHOCPB-GCMYTRPMSA-N |
| XLogP | 3.44 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |