C24H22N8O3 — CID 170959440
7-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]ethyl]-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 170959440) has the molecular formula C24H22N8O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is 7-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]ethyl]-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 7-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]ethyl]-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 170959440 |
| Molecular Formula | C24H22N8O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 7-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]ethyl]-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | Cc1noc(-c2cc3n(c2)CCN(CCNc2nccc4ccc(-c5noc(C)n5)cc24)C3=O)n1 |
| InChI | InChI=1S/C24H22N8O3/c1-14-27-23(35-29-14)18-12-20-24(33)31(9-10-32(20)13-18)8-7-26-22-19-11-17(21-28-15(2)34-30-21)4-3-16(19)5-6-25-22/h3-6,11-13H,7-10H2,1-2H3,(H,25,26) |
| InChIKey | FBDKZYSHHGLQFN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |