About N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine
N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine (PubChem CID 170960578) has the molecular formula C11H14ClN5
and a molecular weight of 251.72 g/mol. Its IUPAC name is N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine.
Molecular Properties
| Compound Name | N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine |
| PubChem CID | 170960578 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine |
| SMILES | [H]/N=C1C(=N\NC)/C(C)N(C)c2c/1ccnc2Cl |
| InChI | InChI=1S/C11H14ClN5/c1-6-9(16-14-2)8(13)7-4-5-15-11(12)10(7)17(6)3/h4-6,13-14H,1-3H3/b13-8+,16-9- |
| InChIKey | WIODWEMRSUPAIH-DLZYAPHWSA-N |
| XLogP | 1.52 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine?
The IUPAC name of N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine (CID 170960578) is N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine.
What is the SMILES notation for N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine?
The canonical SMILES for N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine is [H]/N=C1C(=N\NC)/C(C)N(C)c2c/1ccnc2Cl.
What is the InChIKey of N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine?
The InChIKey is WIODWEMRSUPAIH-DLZYAPHWSA-N. The full InChI is InChI=1S/C11H14ClN5/c1-6-9(16-14-2)8(13)7-4-5-15-11(12)10(7)17(6)3/h4-6,13-14H,1-3H3/b13-8+,16-9-.
What are the key properties of N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine?
N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine has a molecular weight of 251.72 g/mol, XLogP of 1.52, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(8-chloro-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-3-ylidene)amino]methanamine is sourced from PubChem (CID 170960578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).