C18H21BrF2N2O5 — CID 170960852
methyl (2S)-2-[2-(bromomethyl)-3-[2,6-difluoro-4-(methylcarbamoyl)phenyl]-3-oxopropyl]morpholine-4-carboxylate (PubChem CID 170960852) has the molecular formula C18H21BrF2N2O5 and a molecular weight of 463.28 g/mol. Its IUPAC name is methyl (2S)-2-[2-(bromomethyl)-3-[2,6-difluoro-4-(methylcarbamoyl)phenyl]-3-oxopropyl]morpholine-4-carboxylate.
| Compound Name | methyl (2S)-2-[2-(bromomethyl)-3-[2,6-difluoro-4-(methylcarbamoyl)phenyl]-3-oxopropyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170960852 |
| Molecular Formula | C18H21BrF2N2O5 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | methyl (2S)-2-[2-(bromomethyl)-3-[2,6-difluoro-4-(methylcarbamoyl)phenyl]-3-oxopropyl]morpholine-4-carboxylate |
| SMILES | CNC(=O)c1cc(F)c(C(=O)C(CBr)C[C@H]2CN(C(=O)OC)CCO2)c(F)c1 |
| InChI | InChI=1S/C18H21BrF2N2O5/c1-22-17(25)10-6-13(20)15(14(21)7-10)16(24)11(8-19)5-12-9-23(3-4-28-12)18(26)27-2/h6-7,11-12H,3-5,8-9H2,1-2H3,(H,22,25)/t11?,12-/m0/s1 |
| InChIKey | VRSPBHUUKOKBKP-KIYNQFGBSA-N |
| XLogP | 2.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|