C31H34ClF2N5O5 — CID 170961057
tert-butyl (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 170961057) has the molecular formula C31H34ClF2N5O5 and a molecular weight of 630.09 g/mol. Its IUPAC name is tert-butyl (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170961057 |
| Molecular Formula | C31H34ClF2N5O5 |
| Molecular Weight | 630.09 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | tert-butyl (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1O[C@@H]1CN(C(=O)OC(C)(C)C)CC(F)(F)C1 |
| InChI | InChI=1S/C31H34ClF2N5O5/c1-16-7-18(32)9-20(25(16)43-19-10-31(33,34)14-37(13-19)28(42)44-29(2,3)4)24-21-8-17(12-39(21)36-15-35-24)11-38-26(40)22-23(27(38)41)30(22,5)6/h7-9,12,15,19,22-23H,10-11,13-14H2,1-6H3/t19-,22?,23?/m0/s1 |
| InChIKey | RYBLOJNXZLABNN-BVVFMGSASA-N |
| XLogP | 5.52 |
| TPSA | 106.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.09 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|