C27H30Cl2N6O2 — CID 170961114
3-[[4-[5-chloro-2-(1,7-diazaspiro[4.4]nonan-7-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride (PubChem CID 170961114) has the molecular formula C27H30Cl2N6O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-(1,7-diazaspiro[4.4]nonan-7-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride.
| Compound Name | 3-[[4-[5-chloro-2-(1,7-diazaspiro[4.4]nonan-7-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 170961114 |
| Molecular Formula | C27H30Cl2N6O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 3-[[4-[5-chloro-2-(1,7-diazaspiro[4.4]nonan-7-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4c(-c5cc(Cl)ccc5N5CCC6(CCCN6)C5)ncnn4c3)C(=O)C21.Cl |
| InChI | InChI=1S/C27H29ClN6O2.ClH/c1-26(2)21-22(26)25(36)33(24(21)35)12-16-10-20-23(29-15-31-34(20)13-16)18-11-17(28)4-5-19(18)32-9-7-27(14-32)6-3-8-30-27;/h4-5,10-11,13,15,21-22,30H,3,6-9,12,14H2,1-2H3;1H |
| InChIKey | BKHPDRPMBLQUHJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|