C26H26ClF3N6O3 — CID 170961125
3-[[4-[5-chloro-3-methyl-2-[[(6S)-6-methylmorpholin-2-yl]methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 170961125) has the molecular formula C26H26ClF3N6O3 and a molecular weight of 562.98 g/mol. Its IUPAC name is 3-[[4-[5-chloro-3-methyl-2-[[(6S)-6-methylmorpholin-2-yl]methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-3-methyl-2-[[(6S)-6-methylmorpholin-2-yl]methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170961125 |
| Molecular Formula | C26H26ClF3N6O3 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 3-[[4-[5-chloro-3-methyl-2-[[(6S)-6-methylmorpholin-2-yl]methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)cc23)c1CC1CNC[C@H](C)O1 |
| InChI | InChI=1S/C26H26ClF3N6O3/c1-15-5-18(27)7-21(20(15)8-19-10-31-9-16(2)39-19)24-22-6-17(12-36(22)33-14-32-24)11-35-23(37)3-4-34(25(35)38)13-26(28,29)30/h3-7,12,14,16,19,31H,8-11,13H2,1-2H3/t16-,19?/m0/s1 |
| InChIKey | HCHQDOWJILQDAM-UCFFOFKASA-N |
| XLogP | 3.21 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |