C25H25Cl2F3N6O3 — CID 170961164
3-[[4-[5-chloro-3-methyl-2-(morpholin-2-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione;hydrochloride (PubChem CID 170961164) has the molecular formula C25H25Cl2F3N6O3 and a molecular weight of 585.41 g/mol. Its IUPAC name is 3-[[4-[5-chloro-3-methyl-2-(morpholin-2-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 3-[[4-[5-chloro-3-methyl-2-(morpholin-2-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 170961164 |
| Molecular Formula | C25H25Cl2F3N6O3 |
| Molecular Weight | 585.41 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | 3-[[4-[5-chloro-3-methyl-2-(morpholin-2-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)cc23)c1CC1CNCCO1.Cl |
| InChI | InChI=1S/C25H24ClF3N6O3.ClH/c1-15-6-17(26)8-20(19(15)9-18-10-30-3-5-38-18)23-21-7-16(12-35(21)32-14-31-23)11-34-22(36)2-4-33(24(34)37)13-25(27,28)29;/h2,4,6-8,12,14,18,30H,3,5,9-11,13H2,1H3;1H |
| InChIKey | WOVNXCZPPDNJOY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |