C32H37ClFN5O5 — CID 170961184
tert-butyl 2-[[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenyl]methyl]-6-(fluoromethyl)morpholine-4-carboxylate (PubChem CID 170961184) has the molecular formula C32H37ClFN5O5 and a molecular weight of 626.13 g/mol. Its IUPAC name is tert-butyl 2-[[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenyl]methyl]-6-(fluoromethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenyl]methyl]-6-(fluoromethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170961184 |
| Molecular Formula | C32H37ClFN5O5 |
| Molecular Weight | 626.13 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | tert-butyl 2-[[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenyl]methyl]-6-(fluoromethyl)morpholine-4-carboxylate |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1CC1CN(C(=O)OC(C)(C)C)CC(CF)O1 |
| InChI | InChI=1S/C32H37ClFN5O5/c1-17-7-19(33)9-23(22(17)10-20-14-37(15-21(11-34)43-20)30(42)44-31(2,3)4)27-24-8-18(13-39(24)36-16-35-27)12-38-28(40)25-26(29(38)41)32(25,5)6/h7-9,13,16,20-21,25-26H,10-12,14-15H2,1-6H3 |
| InChIKey | NAGSACXBIAKNOU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|