C25H25ClFN5O3 — CID 170961185
3-[[4-[5-chloro-2-[(4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 170961185) has the molecular formula C25H25ClFN5O3 and a molecular weight of 497.96 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-[(4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-2-[(4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 170961185 |
| Molecular Formula | C25H25ClFN5O3 |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 3-[[4-[5-chloro-2-[(4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1OC1CNC[C@@H]1F |
| InChI | InChI=1S/C25H25ClFN5O3/c1-12-4-14(26)6-15(22(12)35-18-8-28-7-16(18)27)21-17-5-13(10-32(17)30-11-29-21)9-31-23(33)19-20(24(31)34)25(19,2)3/h4-6,10-11,16,18-20,28H,7-9H2,1-3H3/t16-,18?,19?,20?/m0/s1 |
| InChIKey | AVUQZFKDKOLOJE-OYPVPUJCSA-N |
| XLogP | 3.19 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|