C27H24ClF4N7O2 — CID 170961382
3-[[4-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 170961382) has the molecular formula C27H24ClF4N7O2 and a molecular weight of 589.98 g/mol. Its IUPAC name is 3-[[4-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170961382 |
| Molecular Formula | C27H24ClF4N7O2 |
| Molecular Weight | 589.98 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 3-[[4-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(F)(F)F)c(=O)n1Cc1cc2c(-c3cc(Cl)cc4ccn(CC5(F)CCNCC5)c34)ncnn2c1 |
| InChI | InChI=1S/C27H24ClF4N7O2/c28-19-10-18-1-7-36(14-26(29)3-5-33-6-4-26)24(18)20(11-19)23-21-9-17(13-39(21)35-16-34-23)12-38-22(40)2-8-37(25(38)41)15-27(30,31)32/h1-2,7-11,13,16,33H,3-6,12,14-15H2 |
| InChIKey | QEKFYHAOBVGKEL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |