C27H29Cl2F2N5O3 — CID 170961422
3-[[4-[5-chloro-2-[(6,6-difluoro-1,4-oxazepan-2-yl)methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride (PubChem CID 170961422) has the molecular formula C27H29Cl2F2N5O3 and a molecular weight of 580.46 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-[(6,6-difluoro-1,4-oxazepan-2-yl)methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride.
| Compound Name | 3-[[4-[5-chloro-2-[(6,6-difluoro-1,4-oxazepan-2-yl)methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 170961422 |
| Molecular Formula | C27H29Cl2F2N5O3 |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 3-[[4-[5-chloro-2-[(6,6-difluoro-1,4-oxazepan-2-yl)methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1CC1CNCC(F)(F)CO1.Cl |
| InChI | InChI=1S/C27H28ClF2N5O3.ClH/c1-14-4-16(28)6-19(18(14)7-17-8-31-11-27(29,30)12-38-17)23-20-5-15(10-35(20)33-13-32-23)9-34-24(36)21-22(25(34)37)26(21,2)3;/h4-6,10,13,17,21-22,31H,7-9,11-12H2,1-3H3;1H |
| InChIKey | UOJKSFDBJQZBGL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|