About methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate
methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate (PubChem CID 170962041) has the molecular formula C20H14ClF2IN2O3
and a molecular weight of 530.70 g/mol. Its IUPAC name is methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate |
| PubChem CID | 170962041 |
| Molecular Formula | C20H14ClF2IN2O3 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate |
| SMILES | COC(=O)C(OC1CC1)(c1cc(F)cc(F)c1)c1nc(Cl)nc2ccc(I)cc12 |
| InChI | InChI=1S/C20H14ClF2IN2O3/c1-28-18(27)20(29-14-3-4-14,10-6-11(22)8-12(23)7-10)17-15-9-13(24)2-5-16(15)25-19(21)26-17/h2,5-9,14H,3-4H2,1H3 |
| InChIKey | BCADHAIZMUYIHF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate?
The IUPAC name of methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate (CID 170962041) is methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate.
What is the SMILES notation for methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate?
The canonical SMILES for methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate is COC(=O)C(OC1CC1)(c1cc(F)cc(F)c1)c1nc(Cl)nc2ccc(I)cc12.
What is the InChIKey of methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate?
The InChIKey is BCADHAIZMUYIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClF2IN2O3/c1-28-18(27)20(29-14-3-4-14,10-6-11(22)8-12(23)7-10)17-15-9-13(24)2-5-16(15)25-19(21)26-17/h2,5-9,14H,3-4H2,1H3.
What are the key properties of methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate?
methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate has a molecular weight of 530.70 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-chloro-6-iodoquinazolin-4-yl)-2-cyclopropyloxy-2-(3,5-difluorophenyl)acetate is sourced from PubChem (CID 170962041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).