About 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide
3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide (PubChem CID 170962780) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide.
Molecular Properties
| Compound Name | 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide |
| PubChem CID | 170962780 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide |
| SMILES | CC1CC2CC2N1.O=CNCc1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C9H9N3O.C6H11N/c13-6-11-5-8-3-7-4-10-2-1-9(7)12-8;1-4-2-5-3-6(5)7-4/h1-4,6,12H,5H2,(H,11,13);4-7H,2-3H2,1H3 |
| InChIKey | ZGDASWMVQOOWGB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide?
The IUPAC name of 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide (CID 170962780) is 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide.
What is the SMILES notation for 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide?
The canonical SMILES for 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide is CC1CC2CC2N1.O=CNCc1cc2cnccc2[nH]1.
What is the InChIKey of 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide?
The InChIKey is ZGDASWMVQOOWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O.C6H11N/c13-6-11-5-8-3-7-4-10-2-1-9(7)12-8;1-4-2-5-3-6(5)7-4/h1-4,6,12H,5H2,(H,11,13);4-7H,2-3H2,1H3.
What are the key properties of 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide?
3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide has a molecular weight of 272.35 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-azabicyclo[3.1.0]hexane;N-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)formamide is sourced from PubChem (CID 170962780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).