C31H36N2O5S2 — CID 170963763
5-[(3R)-7-cyclobutyloxy-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid (PubChem CID 170963763) has the molecular formula C31H36N2O5S2 and a molecular weight of 580.77 g/mol. Its IUPAC name is 5-[(3R)-7-cyclobutyloxy-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(3R)-7-cyclobutyloxy-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170963763 |
| Molecular Formula | C31H36N2O5S2 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 5-[(3R)-7-cyclobutyloxy-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(-c2cc3c(cc2OC2CCC2)N(c2ccccc2)C[C@@H](C2CCCCC2)N(C)S3(=O)=O)sc1C(=O)O |
| InChI | InChI=1S/C31H36N2O5S2/c1-20-16-28(39-30(20)31(34)35)24-17-29-25(18-27(24)38-23-14-9-15-23)33(22-12-7-4-8-13-22)19-26(32(2)40(29,36)37)21-10-5-3-6-11-21/h4,7-8,12-13,16-18,21,23,26H,3,5-6,9-11,14-15,19H2,1-2H3,(H,34,35)/t26-/m0/s1 |
| InChIKey | PNEXQUPBUFXGAX-SANMLTNESA-N |
| XLogP | 7.07 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |