C23H17ClF4NO4PS — CID 170964071
5-[7-chloro-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-1λ6,5,2-benzothiazaphosphepin-8-yl]-2-fluorobenzoic acid (PubChem CID 170964071) has the molecular formula C23H17ClF4NO4PS and a molecular weight of 545.88 g/mol. Its IUPAC name is 5-[7-chloro-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-1λ6,5,2-benzothiazaphosphepin-8-yl]-2-fluorobenzoic acid.
| Compound Name | 5-[7-chloro-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-1λ6,5,2-benzothiazaphosphepin-8-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170964071 |
| Molecular Formula | C23H17ClF4NO4PS |
| Molecular Weight | 545.88 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | 5-[7-chloro-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-1λ6,5,2-benzothiazaphosphepin-8-yl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(-c2cc3c(cc2Cl)N(c2ccccc2)CC(CC(F)(F)F)PS3(=O)=O)ccc1F |
| InChI | InChI=1S/C23H17ClF4NO4PS/c24-18-10-20-21(9-16(18)13-6-7-19(25)17(8-13)22(30)31)35(32,33)34-15(11-23(26,27)28)12-29(20)14-4-2-1-3-5-14/h1-10,15,34H,11-12H2,(H,30,31) |
| InChIKey | NLWQQQCLTNTALR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|