About (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide
(2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide (PubChem CID 170964072) has the molecular formula C12H15BrF2N2O3S
and a molecular weight of 385.23 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide.
Molecular Properties
| Compound Name | (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide |
| PubChem CID | 170964072 |
| Molecular Formula | C12H15BrF2N2O3S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)c1cc(Br)c(F)cc1F)C(N)=O |
| InChI | InChI=1S/C12H15BrF2N2O3S/c1-6(2)3-10(12(16)18)17-21(19,20)11-4-7(13)8(14)5-9(11)15/h4-6,10,17H,3H2,1-2H3,(H2,16,18)/t10-/m1/s1 |
| InChIKey | UZFLLTOLACWPAV-SNVBAGLBSA-N |
| XLogP | 1.91 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide?
The IUPAC name of (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide (CID 170964072) is (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide.
What is the SMILES notation for (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide?
The canonical SMILES for (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide is CC(C)C[C@@H](NS(=O)(=O)c1cc(Br)c(F)cc1F)C(N)=O.
What is the InChIKey of (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide?
The InChIKey is UZFLLTOLACWPAV-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H15BrF2N2O3S/c1-6(2)3-10(12(16)18)17-21(19,20)11-4-7(13)8(14)5-9(11)15/h4-6,10,17H,3H2,1-2H3,(H2,16,18)/t10-/m1/s1.
What are the key properties of (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide?
(2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide has a molecular weight of 385.23 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(5-bromo-2,4-difluorophenyl)sulfonylamino]-4-methylpentanamide is sourced from PubChem (CID 170964072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).