About [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium (PubChem CID 170964437) has the molecular formula C15H24N3O3+
and a molecular weight of 294.37 g/mol. Its IUPAC name is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium.
Molecular Properties
| Compound Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium |
| PubChem CID | 170964437 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium |
| SMILES | CN[N+](C)(C)C(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C15H24N3O3/c1-16-18(2,3)15(21)12-6-4-11(5-7-12)10-17-13(19)8-9-14(17)20/h8-9,11-12,16H,4-7,10H2,1-3H3/q+1 |
| InChIKey | TZGDFDGOEDFPMP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium?
The IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium (CID 170964437) is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium.
What is the SMILES notation for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium?
The canonical SMILES for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium is CN[N+](C)(C)C(=O)C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium?
The InChIKey is TZGDFDGOEDFPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N3O3/c1-16-18(2,3)15(21)12-6-4-11(5-7-12)10-17-13(19)8-9-14(17)20/h8-9,11-12,16H,4-7,10H2,1-3H3/q+1.
What are the key properties of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium?
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium has a molecular weight of 294.37 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]-dimethyl-(methylamino)azanium is sourced from PubChem (CID 170964437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).