About 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one
1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one (PubChem CID 170964719) has the molecular formula C19H20N6O2S
and a molecular weight of 396.48 g/mol. Its IUPAC name is 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one |
| PubChem CID | 170964719 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one |
| SMILES | COc1ccc2cnn(C)c2c1NSc1ccc(-n2cc(C)n(C)c2=O)nc1 |
| InChI | InChI=1S/C19H20N6O2S/c1-12-11-25(19(26)23(12)2)16-8-6-14(10-20-16)28-22-17-15(27-4)7-5-13-9-21-24(3)18(13)17/h5-11,22H,1-4H3 |
| InChIKey | FPUWMJMBCWCSQJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one?
The IUPAC name of 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one (CID 170964719) is 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one.
What is the SMILES notation for 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one?
The canonical SMILES for 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one is COc1ccc2cnn(C)c2c1NSc1ccc(-n2cc(C)n(C)c2=O)nc1.
What is the InChIKey of 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one?
The InChIKey is FPUWMJMBCWCSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6O2S/c1-12-11-25(19(26)23(12)2)16-8-6-14(10-20-16)28-22-17-15(27-4)7-5-13-9-21-24(3)18(13)17/h5-11,22H,1-4H3.
What are the key properties of 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one?
1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one has a molecular weight of 396.48 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanyl-2-pyridinyl]-3,4-dimethylimidazol-2-one is sourced from PubChem (CID 170964719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).