About 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole
4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole (PubChem CID 170965101) has the molecular formula C7H10N2S2
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole |
| PubChem CID | 170965101 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole |
| SMILES | CC1(c2cn[nH]c2)SCCS1 |
| InChI | InChI=1S/C7H10N2S2/c1-7(10-2-3-11-7)6-4-8-9-5-6/h4-5H,2-3H2,1H3,(H,8,9) |
| InChIKey | DWZPSZJRIDKBLT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole?
The IUPAC name of 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole (CID 170965101) is 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole.
What is the SMILES notation for 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole?
The canonical SMILES for 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole is CC1(c2cn[nH]c2)SCCS1.
What is the InChIKey of 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole?
The InChIKey is DWZPSZJRIDKBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S2/c1-7(10-2-3-11-7)6-4-8-9-5-6/h4-5H,2-3H2,1H3,(H,8,9).
What are the key properties of 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole?
4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole has a molecular weight of 186.30 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-dithiolan-2-yl)-1H-pyrazole is sourced from PubChem (CID 170965101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).