C18H21N3O2 — CID 170965967
2-methoxy-3-[1-[(3R,4S)-5-oxaspiro[3.5]non-8-en-3-yl]pyrazol-4-yl]aniline (PubChem CID 170965967) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-methoxy-3-[1-[(3R,4S)-5-oxaspiro[3.5]non-8-en-3-yl]pyrazol-4-yl]aniline.
| Compound Name | 2-methoxy-3-[1-[(3R,4S)-5-oxaspiro[3.5]non-8-en-3-yl]pyrazol-4-yl]aniline |
|---|---|
| PubChem CID | 170965967 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-methoxy-3-[1-[(3R,4S)-5-oxaspiro[3.5]non-8-en-3-yl]pyrazol-4-yl]aniline |
| SMILES | COc1c(N)cccc1-c1cnn([C@@H]2CC[C@]23C=CCCO3)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-22-17-14(5-4-6-15(17)19)13-11-20-21(12-13)16-7-9-18(16)8-2-3-10-23-18/h2,4-6,8,11-12,16H,3,7,9-10,19H2,1H3/t16-,18-/m1/s1 |
| InChIKey | NGJWFRQYDNDXRJ-SJLPKXTDSA-N |
| XLogP | 3.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|