About 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol
2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol (PubChem CID 170966179) has the molecular formula C18H31N3O8
and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol.
Molecular Properties
| Compound Name | 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol |
| PubChem CID | 170966179 |
| Molecular Formula | C18H31N3O8 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol |
| SMILES | CC(C)c1cn(C(COC2OCC(O)CC2O)COC2OCC(O)CC2O)nn1 |
| InChI | InChI=1S/C18H31N3O8/c1-10(2)14-5-21(20-19-14)11(6-26-17-15(24)3-12(22)8-28-17)7-27-18-16(25)4-13(23)9-29-18/h5,10-13,15-18,22-25H,3-4,6-9H2,1-2H3 |
| InChIKey | DEMGRYIYPBEXTR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol?
The IUPAC name of 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol (CID 170966179) is 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol.
What is the SMILES notation for 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol?
The canonical SMILES for 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol is CC(C)c1cn(C(COC2OCC(O)CC2O)COC2OCC(O)CC2O)nn1.
What is the InChIKey of 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol?
The InChIKey is DEMGRYIYPBEXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O8/c1-10(2)14-5-21(20-19-14)11(6-26-17-15(24)3-12(22)8-28-17)7-27-18-16(25)4-13(23)9-29-18/h5,10-13,15-18,22-25H,3-4,6-9H2,1-2H3.
What are the key properties of 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol?
2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol has a molecular weight of 417.46 g/mol, XLogP of -1.09, 8 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-dihydroxyoxan-2-yl)oxy-2-(4-propan-2-yltriazol-1-yl)propoxy]oxane-3,5-diol is sourced from PubChem (CID 170966179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).