About 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one
1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one (PubChem CID 170966267) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one |
| PubChem CID | 170966267 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one |
| SMILES | CCC(C)(C)COCC(C)(C)CN1C(=O)C=CC1O |
| InChI | InChI=1S/C15H27NO3/c1-6-14(2,3)10-19-11-15(4,5)9-16-12(17)7-8-13(16)18/h7-8,12,17H,6,9-11H2,1-5H3 |
| InChIKey | OLTBWPGTKIHCPY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one?
The IUPAC name of 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one (CID 170966267) is 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one.
What is the SMILES notation for 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one?
The canonical SMILES for 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one is CCC(C)(C)COCC(C)(C)CN1C(=O)C=CC1O.
What is the InChIKey of 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one?
The InChIKey is OLTBWPGTKIHCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-6-14(2,3)10-19-11-15(4,5)9-16-12(17)7-8-13(16)18/h7-8,12,17H,6,9-11H2,1-5H3.
What are the key properties of 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one?
1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one has a molecular weight of 269.38 g/mol, XLogP of 2.18, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]-2-hydroxy-2H-pyrrol-5-one is sourced from PubChem (CID 170966267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).