C15H23Br2NO3 — CID 170966410
3,4-dibromo-1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]pyrrole-2,5-dione (PubChem CID 170966410) has the molecular formula C15H23Br2NO3 and a molecular weight of 425.16 g/mol. Its IUPAC name is 3,4-dibromo-1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dibromo-1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170966410 |
| Molecular Formula | C15H23Br2NO3 |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 3,4-dibromo-1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]pyrrole-2,5-dione |
| SMILES | CCC(C)(C)COCC(C)(C)CN1C(=O)C(Br)=C(Br)C1=O |
| InChI | InChI=1S/C15H23Br2NO3/c1-6-14(2,3)8-21-9-15(4,5)7-18-12(19)10(16)11(17)13(18)20/h6-9H2,1-5H3 |
| InChIKey | MEUWQYZSNGJYRE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|