C34H38N7O2+ — CID 170966919
1-[2-ethyl-4-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-2,3-dimethylbut-2-en-1-one (PubChem CID 170966919) has the molecular formula C34H38N7O2+ and a molecular weight of 576.73 g/mol. Its IUPAC name is 1-[2-ethyl-4-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-2,3-dimethylbut-2-en-1-one.
| Compound Name | 1-[2-ethyl-4-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-2,3-dimethylbut-2-en-1-one |
|---|---|
| PubChem CID | 170966919 |
| Molecular Formula | C34H38N7O2+ |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 1-[2-ethyl-4-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-2,3-dimethylbut-2-en-1-one |
| SMILES | CCC1CC(c2ccn3ncnc(Nc4ccc(Oc5ccc6c(c5)ncn6C)c(C)c4)c23)CC=[N+]1C(=O)C(C)=C(C)C |
| InChI | InChI=1S/C34H38N7O2/c1-7-26-17-24(12-14-40(26)34(42)23(5)21(2)3)28-13-15-41-32(28)33(35-19-37-41)38-25-8-11-31(22(4)16-25)43-27-9-10-30-29(18-27)36-20-39(30)6/h8-11,13-16,18-20,24,26H,7,12,17H2,1-6H3,(H,35,37,38)/q+1 |
| InChIKey | UISXPEFJBSODOR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|