C32H35N9O2 — CID 170967048
2-[(dimethylamino)methyl]-1-[5-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one (PubChem CID 170967048) has the molecular formula C32H35N9O2 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-[5-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one.
| Compound Name | 2-[(dimethylamino)methyl]-1-[5-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170967048 |
| Molecular Formula | C32H35N9O2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-[5-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
| SMILES | C=C(CN(C)C)C(=O)N1CC2CCC1CC2c1ccn2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3)c12 |
| InChI | InChI=1S/C32H35N9O2/c1-20-13-23(6-8-28(20)43-25-9-11-40-29(15-25)33-18-35-40)37-31-30-26(10-12-41(30)36-19-34-31)27-14-24-7-5-22(27)17-39(24)32(42)21(2)16-38(3)4/h6,8-13,15,18-19,22,24,27H,2,5,7,14,16-17H2,1,3-4H3,(H,34,36,37) |
| InChIKey | NBWZNBUBMHFJKH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|