C11H13ClN4O — CID 170967077
4-(4-chloropyrrolo[2,1-f][1,2,4]triazin-5-yl)piperidin-4-ol (PubChem CID 170967077) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is 4-(4-chloropyrrolo[2,1-f][1,2,4]triazin-5-yl)piperidin-4-ol.
| Compound Name | 4-(4-chloropyrrolo[2,1-f][1,2,4]triazin-5-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 170967077 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 4-(4-chloropyrrolo[2,1-f][1,2,4]triazin-5-yl)piperidin-4-ol |
| SMILES | OC1(c2ccn3ncnc(Cl)c23)CCNCC1 |
| InChI | InChI=1S/C11H13ClN4O/c12-10-9-8(1-6-16(9)15-7-14-10)11(17)2-4-13-5-3-11/h1,6-7,13,17H,2-5H2 |
| InChIKey | UBAOVJWPEYPJOU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |