C35H36ClFN6O3 — CID 170967403
1-[3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]butane-1,3-dione (PubChem CID 170967403) has the molecular formula C35H36ClFN6O3 and a molecular weight of 643.16 g/mol. Its IUPAC name is 1-[3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]butane-1,3-dione.
| Compound Name | 1-[3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 170967403 |
| Molecular Formula | C35H36ClFN6O3 |
| Molecular Weight | 643.16 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 1-[3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1C2CCC1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(Cl)c45)ncc13)C2 |
| InChI | InChI=1S/C35H36ClFN6O3/c1-21(44)16-28(45)43-23-10-11-24(43)19-41(18-23)33-26-17-38-31(25-8-2-6-22-7-3-9-27(36)29(22)25)30(37)32(26)39-34(40-33)46-20-35-12-4-14-42(35)15-5-13-35/h2-3,6-9,17,23-24H,4-5,10-16,18-20H2,1H3 |
| InChIKey | KELAGNYGPIFQFJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 91.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|