C23H22F2N6O2 — CID 170967749
2,2-difluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide (PubChem CID 170967749) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2,2-difluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-difluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170967749 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2,2-difluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
| SMILES | CC[C@@H](O)c1cc(C)c(-c2cc3cnc(NC(=O)C4CC4(F)F)cc3n3nc(C)nc23)cn1 |
| InChI | InChI=1S/C23H22F2N6O2/c1-4-19(32)17-5-11(2)15(10-26-17)14-6-13-9-27-20(29-22(33)16-8-23(16,24)25)7-18(13)31-21(14)28-12(3)30-31/h5-7,9-10,16,19,32H,4,8H2,1-3H3,(H,27,29,33)/t16?,19-/m1/s1 |
| InChIKey | SLMZPRLZOHIHIQ-LRTDYKAYSA-N |
| XLogP | 3.99 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |