C23H23FN6O2 — CID 170967757
cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxybutyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide (PubChem CID 170967757) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxybutyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxybutyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170967757 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxybutyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
| SMILES | CCC[C@@H](O)c1cc(C)c(-c2cc3cnc(NC(=O)[C@@H]4C[C@@H]4F)cc3n3ncnc23)cn1 |
| InChI | InChI=1S/C23H23FN6O2/c1-3-4-20(31)18-5-12(2)16(10-25-18)14-6-13-9-26-21(29-23(32)15-7-17(15)24)8-19(13)30-22(14)27-11-28-30/h5-6,8-11,15,17,20,31H,3-4,7H2,1-2H3,(H,26,29,32)/t15-,17+,20-/m1/s1 |
| InChIKey | HOWUXWBHOZYEGQ-OXFYSEKESA-N |
| XLogP | 3.78 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |