C22H21FN6O2 — CID 170967871
cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide (PubChem CID 170967871) has the molecular formula C22H21FN6O2 and a molecular weight of 420.45 g/mol. Its IUPAC name is cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170967871 |
| Molecular Formula | C22H21FN6O2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | cis-(1S,2S)-2-fluoro-N-[4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]cyclopropane-1-carboxamide |
| SMILES | CC[C@@H](O)c1cc(C)c(-c2cc3cnc(NC(=O)[C@@H]4C[C@@H]4F)cc3n3ncnc23)cn1 |
| InChI | InChI=1S/C22H21FN6O2/c1-3-19(30)17-4-11(2)15(9-24-17)13-5-12-8-25-20(28-22(31)14-6-16(14)23)7-18(12)29-21(13)26-10-27-29/h4-5,7-10,14,16,19,30H,3,6H2,1-2H3,(H,25,28,31)/t14-,16+,19-/m1/s1 |
| InChIKey | QPMPZQYKIZCXGR-SIXWZSSISA-N |
| XLogP | 3.39 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |