C20H21N7O2S — CID 170969442
1-[4-(3-methylazetidin-1-yl)-2-pyridinyl]-N-(1-methylindazol-7-yl)pyrazole-4-sulfonamide (PubChem CID 170969442) has the molecular formula C20H21N7O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-[4-(3-methylazetidin-1-yl)-2-pyridinyl]-N-(1-methylindazol-7-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[4-(3-methylazetidin-1-yl)-2-pyridinyl]-N-(1-methylindazol-7-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 170969442 |
| Molecular Formula | C20H21N7O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[4-(3-methylazetidin-1-yl)-2-pyridinyl]-N-(1-methylindazol-7-yl)pyrazole-4-sulfonamide |
| SMILES | CC1CN(c2ccnc(-n3cc(S(=O)(=O)Nc4cccc5cnn(C)c45)cn3)c2)C1 |
| InChI | InChI=1S/C20H21N7O2S/c1-14-11-26(12-14)16-6-7-21-19(8-16)27-13-17(10-23-27)30(28,29)24-18-5-3-4-15-9-22-25(2)20(15)18/h3-10,13-14,24H,11-12H2,1-2H3 |
| InChIKey | DMRNEUGXLYRJLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |