About ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine
ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine (PubChem CID 170969539) has the molecular formula C9H16FN3
and a molecular weight of 185.25 g/mol. Its IUPAC name is ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine.
Molecular Properties
| Compound Name | ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine |
| PubChem CID | 170969539 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine |
| SMILES | CC.CNC1(C)C=NC=NC(F)=C1 |
| InChI | InChI=1S/C7H10FN3.C2H6/c1-7(9-2)3-6(8)11-5-10-4-7;1-2/h3-5,9H,1-2H3;1-2H3 |
| InChIKey | LRQRXYZGQMDUOZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine?
The IUPAC name of ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine (CID 170969539) is ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine.
What is the SMILES notation for ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine?
The canonical SMILES for ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine is CC.CNC1(C)C=NC=NC(F)=C1.
What is the InChIKey of ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine?
The InChIKey is LRQRXYZGQMDUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3.C2H6/c1-7(9-2)3-6(8)11-5-10-4-7;1-2/h3-5,9H,1-2H3;1-2H3.
What are the key properties of ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine?
ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine has a molecular weight of 185.25 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-fluoro-N,5-dimethyl-1,3-diazepin-5-amine is sourced from PubChem (CID 170969539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).