C20H18ClN7O2S — CID 170969787
5-[[2-chloro-5-(ethoxymethyl)pyrimidin-4-yl]amino]-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-13-one (PubChem CID 170969787) has the molecular formula C20H18ClN7O2S and a molecular weight of 455.93 g/mol. Its IUPAC name is 5-[[2-chloro-5-(ethoxymethyl)pyrimidin-4-yl]amino]-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-13-one.
| Compound Name | 5-[[2-chloro-5-(ethoxymethyl)pyrimidin-4-yl]amino]-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 170969787 |
| Molecular Formula | C20H18ClN7O2S |
| Molecular Weight | 455.93 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-[[2-chloro-5-(ethoxymethyl)pyrimidin-4-yl]amino]-11-thia-3,6,14,17-tetrazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2,4,6,8,12(18)-hexaen-13-one |
| SMILES | CCOCc1cnc(Cl)nc1Nc1cnc2c(ccc3sc4c(c32)NCCNC4=O)n1 |
| InChI | InChI=1S/C20H18ClN7O2S/c1-2-30-9-10-7-25-20(21)28-18(10)27-13-8-24-15-11(26-13)3-4-12-14(15)16-17(31-12)19(29)23-6-5-22-16/h3-4,7-8,22H,2,5-6,9H2,1H3,(H,23,29)(H,25,26,27,28) |
| InChIKey | BNUFUMKUQXWZCC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |