C30H32N6O4S — CID 170972097
N-tert-butyl-8-(5-carbamoyl-3-pyridinyl)-N-(2-formamidoethyl)-7-methoxy-1-thiophen-3-yl-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 170972097) has the molecular formula C30H32N6O4S and a molecular weight of 572.69 g/mol. Its IUPAC name is N-tert-butyl-8-(5-carbamoyl-3-pyridinyl)-N-(2-formamidoethyl)-7-methoxy-1-thiophen-3-yl-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | N-tert-butyl-8-(5-carbamoyl-3-pyridinyl)-N-(2-formamidoethyl)-7-methoxy-1-thiophen-3-yl-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 170972097 |
| Molecular Formula | C30H32N6O4S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-tert-butyl-8-(5-carbamoyl-3-pyridinyl)-N-(2-formamidoethyl)-7-methoxy-1-thiophen-3-yl-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | COc1cc2c(cc1-c1cncc(C(N)=O)c1)-c1c(c(C(=O)N(CCNC=O)C(C)(C)C)nn1-c1ccsc1)CC2 |
| InChI | InChI=1S/C30H32N6O4S/c1-30(2,3)35(9-8-32-17-37)29(39)26-22-6-5-18-12-25(40-4)23(19-11-20(28(31)38)15-33-14-19)13-24(18)27(22)36(34-26)21-7-10-41-16-21/h7,10-17H,5-6,8-9H2,1-4H3,(H2,31,38)(H,32,37) |
| InChIKey | YPTVSRXSQVEKBU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|