About 12H-isochromeno[4,3-c]cinnoline
12H-isochromeno[4,3-c]cinnoline (PubChem CID 170972479) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 12H-isochromeno[4,3-c]cinnoline.
Molecular Properties
| Compound Name | 12H-isochromeno[4,3-c]cinnoline |
| PubChem CID | 170972479 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 12H-isochromeno[4,3-c]cinnoline |
| SMILES | c1ccc2c(c1)COc1c-2nnc2ccccc12 |
| InChI | InChI=1S/C15H10N2O/c1-2-6-11-10(5-1)9-18-15-12-7-3-4-8-13(12)16-17-14(11)15/h1-8H,9H2 |
| InChIKey | YADOKMHKUJKMBZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 12H-isochromeno[4,3-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-isochromeno[4,3-c]cinnoline?
The IUPAC name of 12H-isochromeno[4,3-c]cinnoline (CID 170972479) is 12H-isochromeno[4,3-c]cinnoline.
What is the SMILES notation for 12H-isochromeno[4,3-c]cinnoline?
The canonical SMILES for 12H-isochromeno[4,3-c]cinnoline is c1ccc2c(c1)COc1c-2nnc2ccccc12.
What is the InChIKey of 12H-isochromeno[4,3-c]cinnoline?
The InChIKey is YADOKMHKUJKMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c1-2-6-11-10(5-1)9-18-15-12-7-3-4-8-13(12)16-17-14(11)15/h1-8H,9H2.
What are the key properties of 12H-isochromeno[4,3-c]cinnoline?
12H-isochromeno[4,3-c]cinnoline has a molecular weight of 234.26 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-isochromeno[4,3-c]cinnoline is sourced from PubChem (CID 170972479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).