About (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol
(5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol (PubChem CID 170972520) has the molecular formula C18H28N2S2
and a molecular weight of 336.57 g/mol. Its IUPAC name is (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol.
Molecular Properties
| Compound Name | (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol |
| PubChem CID | 170972520 |
| Molecular Formula | C18H28N2S2 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol |
| SMILES | CCc1cc2c(cc1CC)N(C(S)(S)[C@H]1CCCN1C)CC2 |
| InChI | InChI=1S/C18H28N2S2/c1-4-13-11-15-8-10-20(16(15)12-14(13)5-2)18(21,22)17-7-6-9-19(17)3/h11-12,17,21-22H,4-10H2,1-3H3/t17-/m1/s1 |
| InChIKey | XARDJAMTLPBLEO-QGZVFWFLSA-N |
| XLogP | 3.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol?
The IUPAC name of (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol (CID 170972520) is (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol.
What is the SMILES notation for (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol?
The canonical SMILES for (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol is CCc1cc2c(cc1CC)N(C(S)(S)[C@H]1CCCN1C)CC2.
What is the InChIKey of (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol?
The InChIKey is XARDJAMTLPBLEO-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H28N2S2/c1-4-13-11-15-8-10-20(16(15)12-14(13)5-2)18(21,22)17-7-6-9-19(17)3/h11-12,17,21-22H,4-10H2,1-3H3/t17-/m1/s1.
What are the key properties of (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol?
(5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol has a molecular weight of 336.57 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-diethyl-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanedithiol is sourced from PubChem (CID 170972520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).