About N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine
N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine (PubChem CID 170972748) has the molecular formula C16H10F6N2O
and a molecular weight of 360.26 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine |
| PubChem CID | 170972748 |
| Molecular Formula | C16H10F6N2O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine |
| SMILES | CN(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1noc2ccccc12 |
| InChI | InChI=1S/C16H10F6N2O/c1-24(14-12-4-2-3-5-13(12)25-23-14)11-7-9(15(17,18)19)6-10(8-11)16(20,21)22/h2-8H,1H3 |
| InChIKey | NKUQFXPYEMNXIH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine (CID 170972748) is N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine is CN(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1noc2ccccc12.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine?
The InChIKey is NKUQFXPYEMNXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6N2O/c1-24(14-12-4-2-3-5-13(12)25-23-14)11-7-9(15(17,18)19)6-10(8-11)16(20,21)22/h2-8H,1H3.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine?
N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine has a molecular weight of 360.26 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-1,2-benzoxazol-3-amine is sourced from PubChem (CID 170972748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).