About 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole
2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole (PubChem CID 170973177) has the molecular formula C10H5ClFN3
and a molecular weight of 221.62 g/mol. Its IUPAC name is 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole.
Molecular Properties
| Compound Name | 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole |
| PubChem CID | 170973177 |
| Molecular Formula | C10H5ClFN3 |
| Molecular Weight | 221.62 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole |
| SMILES | Fc1ccc2c(c1)[nH]c1nc(Cl)ncc12 |
| InChI | InChI=1S/C10H5ClFN3/c11-10-13-4-7-6-2-1-5(12)3-8(6)14-9(7)15-10/h1-4H,(H,13,14,15) |
| InChIKey | ZBUIQMFGTOBEHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole?
The IUPAC name of 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole (CID 170973177) is 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole.
What is the SMILES notation for 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole?
The canonical SMILES for 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole is Fc1ccc2c(c1)[nH]c1nc(Cl)ncc12.
What is the InChIKey of 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole?
The InChIKey is ZBUIQMFGTOBEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClFN3/c11-10-13-4-7-6-2-1-5(12)3-8(6)14-9(7)15-10/h1-4H,(H,13,14,15).
What are the key properties of 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole?
2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole has a molecular weight of 221.62 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-fluoro-9H-pyrimido[4,5-b]indole is sourced from PubChem (CID 170973177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).