About 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol
2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 170973367) has the molecular formula C9H12Cl2N2O
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol |
| PubChem CID | 170973367 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | CC1=CN2CC(O)(C(Cl)Cl)NC2C=C1 |
| InChI | InChI=1S/C9H12Cl2N2O/c1-6-2-3-7-12-9(14,8(10)11)5-13(7)4-6/h2-4,7-8,12,14H,5H2,1H3 |
| InChIKey | NQQQEQWJEPJYQJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol?
The IUPAC name of 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol (CID 170973367) is 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol.
What is the SMILES notation for 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol?
The canonical SMILES for 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol is CC1=CN2CC(O)(C(Cl)Cl)NC2C=C1.
What is the InChIKey of 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol?
The InChIKey is NQQQEQWJEPJYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O/c1-6-2-3-7-12-9(14,8(10)11)5-13(7)4-6/h2-4,7-8,12,14H,5H2,1H3.
What are the key properties of 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol?
2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol has a molecular weight of 235.11 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-6-methyl-3,8a-dihydro-1H-imidazo[1,2-a]pyridin-2-ol is sourced from PubChem (CID 170973367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).