About 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol
5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol (PubChem CID 170973425) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol.
Analyze 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol?
The IUPAC name of 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol (CID 170973425) is 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol.
What is the SMILES notation for 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol?
The canonical SMILES for 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol is OCc1cc2n(n1)COCC2.
What is the InChIKey of 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol?
The InChIKey is GGQWICZMOURAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c10-4-6-3-7-1-2-11-5-9(7)8-6/h3,10H,1-2,4-5H2.
What are the key properties of 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol?
5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol has a molecular weight of 154.17 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylmethanol is sourced from PubChem (CID 170973425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).