C27H31NO3 — CID 17097350
N-[3-(3-methylbutoxy)phenyl]-2-(4-phenylphenoxy)butanamide (PubChem CID 17097350) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[3-(3-methylbutoxy)phenyl]-2-(4-phenylphenoxy)butanamide.
| Compound Name | N-[3-(3-methylbutoxy)phenyl]-2-(4-phenylphenoxy)butanamide |
|---|---|
| PubChem CID | 17097350 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[3-(3-methylbutoxy)phenyl]-2-(4-phenylphenoxy)butanamide |
| SMILES | CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)Nc1cccc(OCCC(C)C)c1 |
| InChI | InChI=1S/C27H31NO3/c1-4-26(31-24-15-13-22(14-16-24)21-9-6-5-7-10-21)27(29)28-23-11-8-12-25(19-23)30-18-17-20(2)3/h5-16,19-20,26H,4,17-18H2,1-3H3,(H,28,29) |
| InChIKey | ARVITQIGWLGUOA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |